C13H11ClN6S — CID 135824301
4-chloro-N-(4-methylphenyl)-5-[(E)-1,2,4-triazol-4-yliminomethyl]-1,3-thiazol-2-amine (PubChem CID 135824301) has the molecular formula C13H11ClN6S and a molecular weight of 318.79 g/mol. Its IUPAC name is 4-chloro-N-(4-methylphenyl)-5-[(E)-1,2,4-triazol-4-yliminomethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-(4-methylphenyl)-5-[(E)-1,2,4-triazol-4-yliminomethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135824301 |
| Molecular Formula | C13H11ClN6S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4-chloro-N-(4-methylphenyl)-5-[(E)-1,2,4-triazol-4-yliminomethyl]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Nc2nc(Cl)c(/C=N/n3cnnc3)s2)cc1 |
| InChI | InChI=1S/C13H11ClN6S/c1-9-2-4-10(5-3-9)18-13-19-12(14)11(21-13)6-17-20-7-15-16-8-20/h2-8H,1H3,(H,18,19)/b17-6+ |
| InChIKey | KPEKDRFDPQOOBD-UBKPWBPPSA-N |
| XLogP | 3.32 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|