C18H14ClN5OS2 — CID 135591109
3-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 135591109) has the molecular formula C18H14ClN5OS2 and a molecular weight of 415.93 g/mol. Its IUPAC name is 3-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135591109 |
| Molecular Formula | C18H14ClN5OS2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 3-[(E)-(2-anilino-4-chloro-1,3-thiazol-5-yl)methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncn(/N=C/c3sc(Nc4ccccc4)nc3Cl)c(=O)c2c1C |
| InChI | InChI=1S/C18H14ClN5OS2/c1-10-11(2)26-16-14(10)17(25)24(9-20-16)21-8-13-15(19)23-18(27-13)22-12-6-4-3-5-7-12/h3-9H,1-2H3,(H,22,23)/b21-8+ |
| InChIKey | WFXQDEHACPDMPH-ODCIPOBUSA-N |
| XLogP | 4.81 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|