C15H12ClN3OS — CID 42992186
3-[(E)-(3-chlorophenyl)methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 42992186) has the molecular formula C15H12ClN3OS and a molecular weight of 317.80 g/mol. Its IUPAC name is 3-[(E)-(3-chlorophenyl)methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(E)-(3-chlorophenyl)methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42992186 |
| Molecular Formula | C15H12ClN3OS |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-[(E)-(3-chlorophenyl)methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncn(/N=C/c3cccc(Cl)c3)c(=O)c2c1C |
| InChI | InChI=1S/C15H12ClN3OS/c1-9-10(2)21-14-13(9)15(20)19(8-17-14)18-7-11-4-3-5-12(16)6-11/h3-8H,1-2H3/b18-7+ |
| InChIKey | CDELRXCATLWFCS-CNHKJKLMSA-N |
| XLogP | 3.61 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|