C25H24FN3O4S — CID 55352803
3-[(E)-[3-ethoxy-4-[2-(4-fluorophenoxy)ethoxy]phenyl]methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 55352803) has the molecular formula C25H24FN3O4S and a molecular weight of 481.55 g/mol. Its IUPAC name is 3-[(E)-[3-ethoxy-4-[2-(4-fluorophenoxy)ethoxy]phenyl]methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(E)-[3-ethoxy-4-[2-(4-fluorophenoxy)ethoxy]phenyl]methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55352803 |
| Molecular Formula | C25H24FN3O4S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 3-[(E)-[3-ethoxy-4-[2-(4-fluorophenoxy)ethoxy]phenyl]methylideneamino]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1cc(/C=N/n2cnc3sc(C)c(C)c3c2=O)ccc1OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FN3O4S/c1-4-31-22-13-18(5-10-21(22)33-12-11-32-20-8-6-19(26)7-9-20)14-28-29-15-27-24-23(25(29)30)16(2)17(3)34-24/h5-10,13-15H,4,11-12H2,1-3H3/b28-14+ |
| InChIKey | OGVCZHSKOOTHAO-CCVNUDIWSA-N |
| XLogP | 4.95 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|