C27H19N5O3S — CID 55352870
5,6-dimethyl-3-[(E)-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]thieno[2,3-d]pyrimidin-4-one (PubChem CID 55352870) has the molecular formula C27H19N5O3S and a molecular weight of 493.55 g/mol. Its IUPAC name is 5,6-dimethyl-3-[(E)-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-3-[(E)-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55352870 |
| Molecular Formula | C27H19N5O3S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 5,6-dimethyl-3-[(E)-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncn(/N=C/c3cn(-c4ccccc4)nc3-c3cc4ccccc4oc3=O)c(=O)c2c1C |
| InChI | InChI=1S/C27H19N5O3S/c1-16-17(2)36-25-23(16)26(33)32(15-28-25)29-13-19-14-31(20-9-4-3-5-10-20)30-24(19)21-12-18-8-6-7-11-22(18)35-27(21)34/h3-15H,1-2H3/b29-13+ |
| InChIKey | SXPRJAQYXKUNRY-VFLNYLIXSA-N |
| XLogP | 4.92 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|