C21H14N6O2 — CID 9014471
3-[1-phenyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]pyrazol-3-yl]chromen-2-one (PubChem CID 9014471) has the molecular formula C21H14N6O2 and a molecular weight of 382.38 g/mol. Its IUPAC name is 3-[1-phenyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]pyrazol-3-yl]chromen-2-one.
| Compound Name | 3-[1-phenyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]pyrazol-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 9014471 |
| Molecular Formula | C21H14N6O2 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[1-phenyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]pyrazol-3-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1nn(-c2ccccc2)cc1/C=N\n1cnnc1 |
| InChI | InChI=1S/C21H14N6O2/c28-21-18(10-15-6-4-5-9-19(15)29-21)20-16(11-24-26-13-22-23-14-26)12-27(25-20)17-7-2-1-3-8-17/h1-14H/b24-11- |
| InChIKey | RKMAXLHRNXNRJZ-MYKKPKGFSA-N |
| XLogP | 3.12 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|