C19H11N2O4- — CID 2333871
3-(2-oxochromen-3-yl)-1-phenylpyrazole-4-carboxylate (PubChem CID 2333871) has the molecular formula C19H11N2O4- and a molecular weight of 331.31 g/mol. Its IUPAC name is 3-(2-oxochromen-3-yl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | 3-(2-oxochromen-3-yl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2333871 |
| Molecular Formula | C19H11N2O4- |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-(2-oxochromen-3-yl)-1-phenylpyrazole-4-carboxylate |
| SMILES | O=C([O-])c1cn(-c2ccccc2)nc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H12N2O4/c22-18(23)15-11-21(13-7-2-1-3-8-13)20-17(15)14-10-12-6-4-5-9-16(12)25-19(14)24/h1-11H,(H,22,23)/p-1 |
| InChIKey | NDBAPMPLOKCROA-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 88.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|