C26H17ClN4O3 — CID 75460469
2-chloro-N-[(E)-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 75460469) has the molecular formula C26H17ClN4O3 and a molecular weight of 468.90 g/mol. Its IUPAC name is 2-chloro-N-[(E)-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[(E)-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 75460469 |
| Molecular Formula | C26H17ClN4O3 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2-chloro-N-[(E)-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cn(-c2ccccc2)nc1-c1cc2ccccc2oc1=O)c1ccccc1Cl |
| InChI | InChI=1S/C26H17ClN4O3/c27-22-12-6-5-11-20(22)25(32)29-28-15-18-16-31(19-9-2-1-3-10-19)30-24(18)21-14-17-8-4-7-13-23(17)34-26(21)33/h1-16H,(H,29,32)/b28-15+ |
| InChIKey | ULOXDOBTIIHYRQ-RWPZCVJISA-N |
| XLogP | 5.06 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|