C17H10Cl2N2O3 — CID 53375224
N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-oxochromene-3-carboxamide (PubChem CID 53375224) has the molecular formula C17H10Cl2N2O3 and a molecular weight of 361.18 g/mol. Its IUPAC name is N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 53375224 |
| Molecular Formula | C17H10Cl2N2O3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | N-[(E)-(2,3-dichlorophenyl)methylideneamino]-2-oxochromene-3-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(Cl)c1Cl)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H10Cl2N2O3/c18-13-6-3-5-11(15(13)19)9-20-21-16(22)12-8-10-4-1-2-7-14(10)24-17(12)23/h1-9H,(H,21,22)/b20-9+ |
| InChIKey | PYLWGZGRJGOKNZ-AWQFTUOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|