C16H9Cl2NO3 — CID 4025638
2,3-dichloro-N-(2-oxochromen-3-yl)benzamide (PubChem CID 4025638) has the molecular formula C16H9Cl2NO3 and a molecular weight of 334.16 g/mol. Its IUPAC name is 2,3-dichloro-N-(2-oxochromen-3-yl)benzamide.
| Compound Name | 2,3-dichloro-N-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 4025638 |
| Molecular Formula | C16H9Cl2NO3 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2,3-dichloro-N-(2-oxochromen-3-yl)benzamide |
| SMILES | O=C(Nc1cc2ccccc2oc1=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H9Cl2NO3/c17-11-6-3-5-10(14(11)18)15(20)19-12-8-9-4-1-2-7-13(9)22-16(12)21/h1-8H,(H,19,20) |
| InChIKey | XPCUCIJEXDFRJI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|