C26H17F3N4O3 — CID 71900301
3-[1-phenyl-4-[[[4-(trifluoromethoxy)phenyl]hydrazinylidene]methyl]pyrazol-3-yl]chromen-2-one (PubChem CID 71900301) has the molecular formula C26H17F3N4O3 and a molecular weight of 490.44 g/mol. Its IUPAC name is 3-[1-phenyl-4-[[[4-(trifluoromethoxy)phenyl]hydrazinylidene]methyl]pyrazol-3-yl]chromen-2-one.
| Compound Name | 3-[1-phenyl-4-[[[4-(trifluoromethoxy)phenyl]hydrazinylidene]methyl]pyrazol-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 71900301 |
| Molecular Formula | C26H17F3N4O3 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3-[1-phenyl-4-[[[4-(trifluoromethoxy)phenyl]hydrazinylidene]methyl]pyrazol-3-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1nn(-c2ccccc2)cc1C=NNc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H17F3N4O3/c27-26(28,29)36-21-12-10-19(11-13-21)31-30-15-18-16-33(20-7-2-1-3-8-20)32-24(18)22-14-17-6-4-5-9-23(17)35-25(22)34/h1-16,31H |
| InChIKey | FCOIINNFSWIDHF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|