C27H19N5O2S — CID 2436493
3-[4-[[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]-1-phenylpyrazol-3-yl]chromen-2-one (PubChem CID 2436493) has the molecular formula C27H19N5O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is 3-[4-[[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]-1-phenylpyrazol-3-yl]chromen-2-one.
| Compound Name | 3-[4-[[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]-1-phenylpyrazol-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 2436493 |
| Molecular Formula | C27H19N5O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 3-[4-[[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]-1-phenylpyrazol-3-yl]chromen-2-one |
| SMILES | Cn1c(=NN=Cc2cn(-c3ccccc3)nc2-c2cc3ccccc3oc2=O)sc2ccccc21 |
| InChI | InChI=1S/C27H19N5O2S/c1-31-22-12-6-8-14-24(22)35-27(31)29-28-16-19-17-32(20-10-3-2-4-11-20)30-25(19)21-15-18-9-5-7-13-23(18)34-26(21)33/h2-17H,1H3 |
| InChIKey | YVJGMWAUKKBLOK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|