C30H28N4O4S — CID 23931111
N,N-diethyl-5-methyl-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzenesulfonamide (PubChem CID 23931111) has the molecular formula C30H28N4O4S and a molecular weight of 540.65 g/mol. Its IUPAC name is N,N-diethyl-5-methyl-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzenesulfonamide.
| Compound Name | N,N-diethyl-5-methyl-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 23931111 |
| Molecular Formula | C30H28N4O4S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N,N-diethyl-5-methyl-2-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C)ccc1/N=C/c1cn(-c2ccccc2)nc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C30H28N4O4S/c1-4-33(5-2)39(36,37)28-17-21(3)15-16-26(28)31-19-23-20-34(24-12-7-6-8-13-24)32-29(23)25-18-22-11-9-10-14-27(22)38-30(25)35/h6-20H,4-5H2,1-3H3/b31-19+ |
| InChIKey | JPRAGVCVPZBCEC-ZCTHSVRISA-N |
| XLogP | 5.74 |
| TPSA | 97.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|