C25H18N4O4S — CID 5234334
N-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzenesulfonamide (PubChem CID 5234334) has the molecular formula C25H18N4O4S and a molecular weight of 470.51 g/mol. Its IUPAC name is N-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzenesulfonamide.
| Compound Name | N-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 5234334 |
| Molecular Formula | C25H18N4O4S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzenesulfonamide |
| SMILES | O=c1oc2ccccc2cc1-c1nn(-c2ccccc2)cc1C=NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H18N4O4S/c30-25-22(15-18-9-7-8-14-23(18)33-25)24-19(17-29(27-24)20-10-3-1-4-11-20)16-26-28-34(31,32)21-12-5-2-6-13-21/h1-17,28H |
| InChIKey | IELUSWNFXJWOTJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|