C19H25N3O3S2 — CID 43076238
1-(3-ethoxypropyl)-3-[4-methyl-3-(phenylsulfamoyl)phenyl]thiourea (PubChem CID 43076238) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[4-methyl-3-(phenylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-[4-methyl-3-(phenylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 43076238 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[4-methyl-3-(phenylsulfamoyl)phenyl]thiourea |
| SMILES | CCOCCCNC(=S)Nc1ccc(C)c(S(=O)(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-3-25-13-7-12-20-19(26)21-17-11-10-15(2)18(14-17)27(23,24)22-16-8-5-4-6-9-16/h4-6,8-11,14,22H,3,7,12-13H2,1-2H3,(H2,20,21,26) |
| InChIKey | SVRPWDCULZLMHE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|