C7H6N4O2S2 — CID 137271628
2-cyano-N-[(Z)-(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylideneamino]acetamide (PubChem CID 137271628) has the molecular formula C7H6N4O2S2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-cyano-N-[(Z)-(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-cyano-N-[(Z)-(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137271628 |
| Molecular Formula | C7H6N4O2S2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 2-cyano-N-[(Z)-(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)methylideneamino]acetamide |
| SMILES | N#CCC(=O)N/N=C\c1sc(=S)[nH]c1O |
| InChI | InChI=1S/C7H6N4O2S2/c8-2-1-5(12)11-9-3-4-6(13)10-7(14)15-4/h3,13H,1H2,(H,10,14)(H,11,12)/b9-3- |
| InChIKey | SRCRDEWPWDZZGW-OQFOIZHKSA-N |
| XLogP | 0.88 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|