C18H14IN5O2 — CID 5348924
2-[[2-iodo-6-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]methyl]benzonitrile (PubChem CID 5348924) has the molecular formula C18H14IN5O2 and a molecular weight of 459.25 g/mol. Its IUPAC name is 2-[[2-iodo-6-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-iodo-6-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 5348924 |
| Molecular Formula | C18H14IN5O2 |
| Molecular Weight | 459.25 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | 2-[[2-iodo-6-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=N/n2cnnc2)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C18H14IN5O2/c1-25-17-7-13(9-23-24-11-21-22-12-24)6-16(19)18(17)26-10-15-5-3-2-4-14(15)8-20/h2-7,9,11-12H,10H2,1H3/b23-9+ |
| InChIKey | HUVOMLJWPASEPZ-NUGSKGIGSA-N |
| XLogP | 3.22 |
| TPSA | 85.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|