C25H22IN3O5 — CID 126373656
N-[(Z)-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 126373656) has the molecular formula C25H22IN3O5 and a molecular weight of 571.37 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[(Z)-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 126373656 |
| Molecular Formula | C25H22IN3O5 |
| Molecular Weight | 571.37 g/mol |
| Exact Mass | 571.06 |
| IUPAC Name | N-[(Z)-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C\c2cc(I)c(OCc3ccccc3C#N)c(OC)c2)c1 |
| InChI | InChI=1S/C25H22IN3O5/c1-31-20-10-19(11-21(12-20)32-2)25(30)29-28-14-16-8-22(26)24(23(9-16)33-3)34-15-18-7-5-4-6-17(18)13-27/h4-12,14H,15H2,1-3H3,(H,29,30)/b28-14- |
| InChIKey | XIFICENJZCJWHI-MUXKCCDJSA-N |
| XLogP | 4.53 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|