C24H19ClN4O6 — CID 3375588
N-(4-chlorophenyl)-2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-nitrophenoxy]acetamide (PubChem CID 3375588) has the molecular formula C24H19ClN4O6 and a molecular weight of 494.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-nitrophenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-nitrophenoxy]acetamide |
|---|---|
| PubChem CID | 3375588 |
| Molecular Formula | C24H19ClN4O6 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]-2-nitrophenoxy]acetamide |
| SMILES | O=C(COc1ccc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc1[N+](=O)[O-])Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN4O6/c25-16-4-6-17(7-5-16)27-20(30)12-35-19-8-1-13(9-18(19)29(33)34)11-26-28-23(31)21-14-2-3-15(10-14)22(21)24(28)32/h1-9,11,14-15,21-22H,10,12H2,(H,27,30) |
| InChIKey | BBKAZYVFTPTWIA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|