C24H19ClIN3O4 — CID 126412341
N-(4-chlorophenyl)-2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-iodophenoxy]acetamide (PubChem CID 126412341) has the molecular formula C24H19ClIN3O4 and a molecular weight of 575.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-iodophenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-iodophenoxy]acetamide |
|---|---|
| PubChem CID | 126412341 |
| Molecular Formula | C24H19ClIN3O4 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.01 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-iodophenoxy]acetamide |
| SMILES | O=C(COc1ccc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc1I)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClIN3O4/c25-16-4-6-17(7-5-16)28-20(30)12-33-19-8-1-13(9-18(19)26)11-27-29-23(31)21-14-2-3-15(10-14)22(21)24(29)32/h1-9,11,14-15,21-22H,10,12H2,(H,28,30)/t14-,15-,21-,22+/m0/s1 |
| InChIKey | WFTPICNQYBDPTE-YKTUVVHCSA-N |
| XLogP | 4.10 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|