C25H21I2N3O4 — CID 126412654
2-[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,6-diiodophenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126412654) has the molecular formula C25H21I2N3O4 and a molecular weight of 681.27 g/mol. Its IUPAC name is 2-[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,6-diiodophenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,6-diiodophenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126412654 |
| Molecular Formula | C25H21I2N3O4 |
| Molecular Weight | 681.27 g/mol |
| Exact Mass | 680.96 |
| IUPAC Name | 2-[4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2,6-diiodophenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(I)cc(C=NN3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)cc2I)cc1 |
| InChI | InChI=1S/C25H21I2N3O4/c1-13-2-6-17(7-3-13)29-20(31)12-34-23-18(26)8-14(9-19(23)27)11-28-30-24(32)21-15-4-5-16(10-15)22(21)25(30)33/h2-9,11,15-16,21-22H,10,12H2,1H3,(H,29,31)/t15-,16-,21-,22+/m0/s1 |
| InChIKey | XGJNBMRGEUAZEE-WWLNLUSPSA-N |
| XLogP | 4.36 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|