C25H22IN3O4 — CID 126409951
2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-iodophenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126409951) has the molecular formula C25H22IN3O4 and a molecular weight of 555.37 g/mol. Its IUPAC name is 2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-iodophenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-iodophenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126409951 |
| Molecular Formula | C25H22IN3O4 |
| Molecular Weight | 555.37 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | 2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-iodophenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C=NN3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)cc2I)cc1 |
| InChI | InChI=1S/C25H22IN3O4/c1-14-2-7-18(8-3-14)28-21(30)13-33-20-9-4-15(10-19(20)26)12-27-29-24(31)22-16-5-6-17(11-16)23(22)25(29)32/h2-10,12,16-17,22-23H,11,13H2,1H3,(H,28,30)/t16-,17-,22-,23+/m0/s1 |
| InChIKey | OFACBJJTEVVLIS-BSWISCRUSA-N |
| XLogP | 3.76 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|