C23H18Br2N4O6 — CID 126408911
(1R,2S,6R,7R)-4-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126408911) has the molecular formula C23H18Br2N4O6 and a molecular weight of 606.23 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-4-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126408911 |
| Molecular Formula | C23H18Br2N4O6 |
| Molecular Weight | 606.23 g/mol |
| Exact Mass | 603.96 |
| IUPAC Name | (1R,2S,6R,7R)-4-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCOc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(Br)c(Br)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C23H18Br2N4O6/c1-2-34-15-8-13(9-27-28-22(30)17-11-3-4-12(7-11)18(17)23(28)31)19(24)20(25)21(15)35-16-6-5-14(10-26-16)29(32)33/h3-6,8-12,17-18H,2,7H2,1H3/t11-,12-,17-,18+/m0/s1 |
| InChIKey | CUPPUPNYWAXWLV-GNTOHDJUSA-N |
| XLogP | 4.85 |
| TPSA | 124.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|