C21H16N4O5 — CID 4029043
4-[[3-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 4029043) has the molecular formula C21H16N4O5 and a molecular weight of 404.38 g/mol. Its IUPAC name is 4-[[3-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[[3-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 4029043 |
| Molecular Formula | C21H16N4O5 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-[[3-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1N=Cc1cccc(Oc2ccc([N+](=O)[O-])cn2)c1 |
| InChI | InChI=1S/C21H16N4O5/c26-20-18-13-4-5-14(9-13)19(18)21(27)24(20)23-10-12-2-1-3-16(8-12)30-17-7-6-15(11-22-17)25(28)29/h1-8,10-11,13-14,18-19H,9H2 |
| InChIKey | XDKFEDKMRYCUJJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 115.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|