C15H11N3O5 — CID 98130360
(3aR,4S,7S,7aR)-2-[(Z)-(3-nitrophenyl)methylideneamino]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98130360) has the molecular formula C15H11N3O5 and a molecular weight of 313.27 g/mol. Its IUPAC name is (3aR,4S,7S,7aR)-2-[(Z)-(3-nitrophenyl)methylideneamino]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7S,7aR)-2-[(Z)-(3-nitrophenyl)methylideneamino]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98130360 |
| Molecular Formula | C15H11N3O5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (3aR,4S,7S,7aR)-2-[(Z)-(3-nitrophenyl)methylideneamino]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1/N=C\c1cccc([N+](=O)[O-])c1)[C@@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C15H11N3O5/c19-14-12-10-4-5-11(23-10)13(12)15(20)17(14)16-7-8-2-1-3-9(6-8)18(21)22/h1-7,10-13H/b16-7-/t10-,11-,12-,13-/m0/s1 |
| InChIKey | HFWSERJXEFXYQE-BREMYITKSA-N |
| XLogP | 0.87 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|