C20H20BrN3O5 — CID 5100013
4-[[5-bromo-2-[(2-methylpropan-2-yl)oxy]-3-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 5100013) has the molecular formula C20H20BrN3O5 and a molecular weight of 462.30 g/mol. Its IUPAC name is 4-[[5-bromo-2-[(2-methylpropan-2-yl)oxy]-3-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[[5-bromo-2-[(2-methylpropan-2-yl)oxy]-3-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 5100013 |
| Molecular Formula | C20H20BrN3O5 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 4-[[5-bromo-2-[(2-methylpropan-2-yl)oxy]-3-nitrophenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(C)(C)Oc1c(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20BrN3O5/c1-20(2,3)29-17-12(7-13(21)8-14(17)24(27)28)9-22-23-18(25)15-10-4-5-11(6-10)16(15)19(23)26/h4-5,7-11,15-16H,6H2,1-3H3 |
| InChIKey | LMFLJIKOKUYDOP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|