C20H19N3O8 — CID 126409840
(2S)-2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]propanoic acid (PubChem CID 126409840) has the molecular formula C20H19N3O8 and a molecular weight of 429.39 g/mol. Its IUPAC name is (2S)-2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]propanoic acid |
|---|---|
| PubChem CID | 126409840 |
| Molecular Formula | C20H19N3O8 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | (2S)-2-[4-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]propanoic acid |
| SMILES | COc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc([N+](=O)[O-])c1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C20H19N3O8/c1-9(20(26)27)31-17-13(23(28)29)5-10(6-14(17)30-2)8-21-22-18(24)15-11-3-4-12(7-11)16(15)19(22)25/h3-6,8-9,11-12,15-16H,7H2,1-2H3,(H,26,27)/t9-,11-,12-,15-,16+/m0/s1 |
| InChIKey | GYKMPTVROJUJCR-UKXMPADASA-N |
| XLogP | 1.60 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|