C21H19N3O4 — CID 126414458
(2S)-2-[3-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]indol-1-yl]propanoic acid (PubChem CID 126414458) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is (2S)-2-[3-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]indol-1-yl]propanoic acid.
| Compound Name | (2S)-2-[3-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 126414458 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2S)-2-[3-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]indol-1-yl]propanoic acid |
| SMILES | C[C@@H](C(=O)O)n1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c2ccccc21 |
| InChI | InChI=1S/C21H19N3O4/c1-11(21(27)28)23-10-14(15-4-2-3-5-16(15)23)9-22-24-19(25)17-12-6-7-13(8-12)18(17)20(24)26/h2-7,9-13,17-18H,8H2,1H3,(H,27,28)/t11-,12-,13-,17-,18+/m0/s1 |
| InChIKey | YYFXIDCHPUCKRB-HHDFAXHISA-N |
| XLogP | 2.43 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|