C19H20N2O2 — CID 4665056
4-[(4-propan-2-ylphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 4665056) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[(4-propan-2-ylphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[(4-propan-2-ylphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 4665056 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-[(4-propan-2-ylphenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(C)c1ccc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-11(2)13-5-3-12(4-6-13)10-20-21-18(22)16-14-7-8-15(9-14)17(16)19(21)23/h3-8,10-11,14-17H,9H2,1-2H3 |
| InChIKey | KGFDJDMJDVVOSL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|