C17H13N3O2 — CID 3900025
4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]benzonitrile (PubChem CID 3900025) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]benzonitrile.
| Compound Name | 4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 3900025 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]benzonitrile |
| SMILES | N#Cc1ccc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C17H13N3O2/c18-8-10-1-3-11(4-2-10)9-19-20-16(21)14-12-5-6-13(7-12)15(14)17(20)22/h1-6,9,12-15H,7H2 |
| InChIKey | MKPPFSIWUSMRAE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|