C16H12Cl2N2O2 — CID 3327695
4-[(3,4-dichlorophenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 3327695) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[(3,4-dichlorophenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 3327695 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1N=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O2/c17-11-4-1-8(5-12(11)18)7-19-20-15(21)13-9-2-3-10(6-9)14(13)16(20)22/h1-5,7,9-10,13-14H,6H2 |
| InChIKey | MMSMRAIFSBCRCT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|