C23H22N4O3 — CID 124832886
3-[3-[(Z)-[(1S,2R,6S,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]iminomethyl]indol-1-yl]propanamide (PubChem CID 124832886) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[3-[(Z)-[(1S,2R,6S,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]iminomethyl]indol-1-yl]propanamide.
| Compound Name | 3-[3-[(Z)-[(1S,2R,6S,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]iminomethyl]indol-1-yl]propanamide |
|---|---|
| PubChem CID | 124832886 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-[3-[(Z)-[(1S,2R,6S,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]iminomethyl]indol-1-yl]propanamide |
| SMILES | NC(=O)CCn1cc(/C=N\N2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@@H]45)[C@@H]3C2=O)c2ccccc21 |
| InChI | InChI=1S/C23H22N4O3/c24-19(28)7-8-26-11-12(13-3-1-2-4-18(13)26)10-25-27-22(29)20-14-5-6-15(17-9-16(14)17)21(20)23(27)30/h1-6,10-11,14-17,20-21H,7-9H2,(H2,24,28)/b25-10-/t14-,15-,16-,17-,20-,21+/m0/s1 |
| InChIKey | LHRSBOJCPXFDFM-NEWYEKPHSA-N |
| XLogP | 1.90 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|