C28H24N2O3 — CID 126151310
(1R,2R,6R,7R)-4-[(Z)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 126151310) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-[(Z)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-[(Z)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126151310 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (1R,2R,6R,7R)-4-[(Z)-[2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1/N=C\c1ccccc1OCc1cccc3ccccc13)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C28H24N2O3/c31-27-25-19-12-13-20(15-14-19)26(25)28(32)30(27)29-16-21-7-2-4-11-24(21)33-17-22-9-5-8-18-6-1-3-10-23(18)22/h1-13,16,19-20,25-26H,14-15,17H2/b29-16-/t19-,20-,25+,26+/m0/s1 |
| InChIKey | MLGOEQXUJBNOLS-UNOFUXSZSA-N |
| XLogP | 4.95 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|