C29H27N3O3 — CID 3886054
4-[[4-(dimethylamino)-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 3886054) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[[4-(dimethylamino)-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 3886054 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 4-[[4-(dimethylamino)-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CN(C)c1ccc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)c(OCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C29H27N3O3/c1-31(2)23-13-12-21(16-30-32-28(33)26-19-10-11-20(14-19)27(26)29(32)34)25(15-23)35-17-22-8-5-7-18-6-3-4-9-24(18)22/h3-13,15-16,19-20,26-27H,14,17H2,1-2H3 |
| InChIKey | BHEUYIAPGQZYOT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|