C20H22N4O4 — CID 3341969
2-[5-(dimethylamino)-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetamide (PubChem CID 3341969) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[5-(dimethylamino)-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetamide.
| Compound Name | 2-[5-(dimethylamino)-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 3341969 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[5-(dimethylamino)-2-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]phenoxy]acetamide |
| SMILES | CN(C)c1ccc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)c(OCC(N)=O)c1 |
| InChI | InChI=1S/C20H22N4O4/c1-23(2)14-6-5-13(15(8-14)28-10-16(21)25)9-22-24-19(26)17-11-3-4-12(7-11)18(17)20(24)27/h3-6,8-9,11-12,17-18H,7,10H2,1-2H3,(H2,21,25) |
| InChIKey | CACLXKNZXKDKKU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|