C24H19N3O — CID 21209389
(Z)-2-cyano-3-(1,2-dimethylindol-3-yl)-N-naphthalen-2-ylprop-2-enamide (PubChem CID 21209389) has the molecular formula C24H19N3O and a molecular weight of 365.44 g/mol. Its IUPAC name is (Z)-2-cyano-3-(1,2-dimethylindol-3-yl)-N-naphthalen-2-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(1,2-dimethylindol-3-yl)-N-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 21209389 |
| Molecular Formula | C24H19N3O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (Z)-2-cyano-3-(1,2-dimethylindol-3-yl)-N-naphthalen-2-ylprop-2-enamide |
| SMILES | Cc1c(/C=C(/C#N)C(=O)Nc2ccc3ccccc3c2)c2ccccc2n1C |
| InChI | InChI=1S/C24H19N3O/c1-16-22(21-9-5-6-10-23(21)27(16)2)14-19(15-25)24(28)26-20-12-11-17-7-3-4-8-18(17)13-20/h3-14H,1-2H3,(H,26,28)/b19-14- |
| InChIKey | SHARHVXJXNEQSP-RGEXLXHISA-N |
| XLogP | 5.19 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|