C27H22ClN3O2 — CID 19574884
(Z)-3-[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]-2-cyano-N-(3-methoxyphenyl)prop-2-enamide (PubChem CID 19574884) has the molecular formula C27H22ClN3O2 and a molecular weight of 455.95 g/mol. Its IUPAC name is (Z)-3-[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]-2-cyano-N-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]-2-cyano-N-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19574884 |
| Molecular Formula | C27H22ClN3O2 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (Z)-3-[1-[(2-chlorophenyl)methyl]-2-methylindol-3-yl]-2-cyano-N-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(NC(=O)/C(C#N)=C\c2c(C)n(Cc3ccccc3Cl)c3ccccc23)c1 |
| InChI | InChI=1S/C27H22ClN3O2/c1-18-24(14-20(16-29)27(32)30-21-9-7-10-22(15-21)33-2)23-11-4-6-13-26(23)31(18)17-19-8-3-5-12-25(19)28/h3-15H,17H2,1-2H3,(H,30,32)/b20-14- |
| InChIKey | OYWVAEMHSQPZRF-ZHZULCJRSA-N |
| XLogP | 6.21 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|