C38H39NO4 — CID 74974644
4-[(9-ethylcarbazol-3-yl)methylidene]-1-(4-hydroxy-3-methoxyphenyl)-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione (PubChem CID 74974644) has the molecular formula C38H39NO4 and a molecular weight of 573.73 g/mol. Its IUPAC name is 4-[(9-ethylcarbazol-3-yl)methylidene]-1-(4-hydroxy-3-methoxyphenyl)-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | 4-[(9-ethylcarbazol-3-yl)methylidene]-1-(4-hydroxy-3-methoxyphenyl)-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 74974644 |
| Molecular Formula | C38H39NO4 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | 4-[(9-ethylcarbazol-3-yl)methylidene]-1-(4-hydroxy-3-methoxyphenyl)-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione |
| SMILES | CCn1c2ccccc2c2cc(C=C(C(=O)C=CC3=C(C)CCCC3(C)C)C(=O)C=Cc3ccc(O)c(OC)c3)ccc21 |
| InChI | InChI=1S/C38H39NO4/c1-6-39-32-12-8-7-11-28(32)29-22-27(13-17-33(29)39)23-30(34(40)18-14-26-15-19-36(42)37(24-26)43-5)35(41)20-16-31-25(2)10-9-21-38(31,3)4/h7-8,11-20,22-24,42H,6,9-10,21H2,1-5H3 |
| InChIKey | MXXJUUAWDUNUJY-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|