C31H34O7 — CID 46236212
(1E,4Z,6E)-1-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-7-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione (PubChem CID 46236212) has the molecular formula C31H34O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is (1E,4Z,6E)-1-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-7-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,4Z,6E)-1-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-7-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 46236212 |
| Molecular Formula | C31H34O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | (1E,4Z,6E)-1-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-7-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C(\C(=O)/C=C/C2=C(C)C(O)CCC2(C)C)C(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C31H34O7/c1-19-23(31(2,3)15-14-24(19)32)9-13-26(34)22(16-21-8-12-28(36)30(18-21)38-5)25(33)10-6-20-7-11-27(35)29(17-20)37-4/h6-13,16-18,24,32,35-36H,14-15H2,1-5H3/b10-6+,13-9+,22-16- |
| InChIKey | VQQGNSZDMKVBQI-FUWKMKCDSA-N |
| XLogP | 5.40 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|