C39H41NO3 — CID 58442636
(1E,4Z,6E)-4-[(9-ethylcarbazol-3-yl)methylidene]-1-(3-methoxy-4-methylphenyl)-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione (PubChem CID 58442636) has the molecular formula C39H41NO3 and a molecular weight of 571.76 g/mol. Its IUPAC name is (1E,4Z,6E)-4-[(9-ethylcarbazol-3-yl)methylidene]-1-(3-methoxy-4-methylphenyl)-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,4Z,6E)-4-[(9-ethylcarbazol-3-yl)methylidene]-1-(3-methoxy-4-methylphenyl)-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 58442636 |
| Molecular Formula | C39H41NO3 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | (1E,4Z,6E)-4-[(9-ethylcarbazol-3-yl)methylidene]-1-(3-methoxy-4-methylphenyl)-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-1,6-diene-3,5-dione |
| SMILES | CCn1c2ccccc2c2cc(/C=C(\C(=O)/C=C/C3=C(C)CCCC3(C)C)C(=O)/C=C/c3ccc(C)c(OC)c3)ccc21 |
| InChI | InChI=1S/C39H41NO3/c1-7-40-34-13-9-8-12-30(34)31-23-29(16-19-35(31)40)24-32(36(41)20-17-28-15-14-27(3)38(25-28)43-6)37(42)21-18-33-26(2)11-10-22-39(33,4)5/h8-9,12-21,23-25H,7,10-11,22H2,1-6H3/b20-17+,21-18+,32-24- |
| InChIKey | AXQDNGYUYRKTLT-RIKOHWTASA-N |
| XLogP | 9.45 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|