C27H29N3O4 — CID 177397840
4-[(E)-5-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]oxypentoxyiminomethyl]benzene-1,2-diol (PubChem CID 177397840) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[(E)-5-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]oxypentoxyiminomethyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-5-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]oxypentoxyiminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 177397840 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-[(E)-5-[(E)-(9-ethylcarbazol-3-yl)methylideneamino]oxypentoxyiminomethyl]benzene-1,2-diol |
| SMILES | CCn1c2ccccc2c2cc(/C=N/OCCCCCO/N=C/c3ccc(O)c(O)c3)ccc21 |
| InChI | InChI=1S/C27H29N3O4/c1-2-30-24-9-5-4-8-22(24)23-16-20(10-12-25(23)30)18-28-33-14-6-3-7-15-34-29-19-21-11-13-26(31)27(32)17-21/h4-5,8-13,16-19,31-32H,2-3,6-7,14-15H2,1H3/b28-18+,29-19+ |
| InChIKey | ZXWSBIQJJHPSNE-UOSOPFLXSA-N |
| XLogP | 5.80 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|