C22H20N4O — CID 5432015
1-[(Z)-(9-ethylcarbazol-3-yl)methylideneamino]-3-phenylurea (PubChem CID 5432015) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-[(Z)-(9-ethylcarbazol-3-yl)methylideneamino]-3-phenylurea.
| Compound Name | 1-[(Z)-(9-ethylcarbazol-3-yl)methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 5432015 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[(Z)-(9-ethylcarbazol-3-yl)methylideneamino]-3-phenylurea |
| SMILES | CCn1c2ccccc2c2cc(/C=N\NC(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C22H20N4O/c1-2-26-20-11-7-6-10-18(20)19-14-16(12-13-21(19)26)15-23-25-22(27)24-17-8-4-3-5-9-17/h3-15H,2H2,1H3,(H2,24,25,27)/b23-15- |
| InChIKey | YVZPLSXYHJTVGM-HAHDFKILSA-N |
| XLogP | 4.97 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|