C24H18ClN3OS — CID 5172724
3-chloro-N-[(9-ethylcarbazol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 5172724) has the molecular formula C24H18ClN3OS and a molecular weight of 431.95 g/mol. Its IUPAC name is 3-chloro-N-[(9-ethylcarbazol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(9-ethylcarbazol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 5172724 |
| Molecular Formula | C24H18ClN3OS |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 3-chloro-N-[(9-ethylcarbazol-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(C=NNC(=O)c3sc4ccccc4c3Cl)ccc21 |
| InChI | InChI=1S/C24H18ClN3OS/c1-2-28-19-9-5-3-7-16(19)18-13-15(11-12-20(18)28)14-26-27-24(29)23-22(25)17-8-4-6-10-21(17)30-23/h3-14H,2H2,1H3,(H,27,29) |
| InChIKey | MYDIMJRYYYSCEP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|