C39H35NO5 — CID 20582109
[4-[(E)-1-(4-methoxyphenyl)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl] 2-oxopropyl carbonate (PubChem CID 20582109) has the molecular formula C39H35NO5 and a molecular weight of 597.71 g/mol. Its IUPAC name is [4-[(E)-1-(4-methoxyphenyl)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl] 2-oxopropyl carbonate.
| Compound Name | [4-[(E)-1-(4-methoxyphenyl)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl] 2-oxopropyl carbonate |
|---|---|
| PubChem CID | 20582109 |
| Molecular Formula | C39H35NO5 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | [4-[(E)-1-(4-methoxyphenyl)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl] 2-oxopropyl carbonate |
| SMILES | COc1ccc(/C(=C\c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)c2ccc(OC(=O)OCC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C39H35NO5/c1-27-5-15-33(16-6-27)40(34-17-7-28(2)8-18-34)35-19-9-30(10-20-35)25-38(31-11-21-36(43-4)22-12-31)32-13-23-37(24-14-32)45-39(42)44-26-29(3)41/h5-25H,26H2,1-4H3/b38-25+ |
| InChIKey | QJUFCWNKPNRFQU-XPGZBYHPSA-N |
| XLogP | 9.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|