C28H25N5O2 — CID 142735809
2-[4-[4-[(Z)-1-cyano-2-(4-methoxyphenyl)ethenyl]phenyl]triazol-1-yl]-N-methyl-N-phenylpropanamide (PubChem CID 142735809) has the molecular formula C28H25N5O2 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-[4-[4-[(Z)-1-cyano-2-(4-methoxyphenyl)ethenyl]phenyl]triazol-1-yl]-N-methyl-N-phenylpropanamide.
| Compound Name | 2-[4-[4-[(Z)-1-cyano-2-(4-methoxyphenyl)ethenyl]phenyl]triazol-1-yl]-N-methyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 142735809 |
| Molecular Formula | C28H25N5O2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[4-[4-[(Z)-1-cyano-2-(4-methoxyphenyl)ethenyl]phenyl]triazol-1-yl]-N-methyl-N-phenylpropanamide |
| SMILES | COc1ccc(/C=C(\C#N)c2ccc(-c3cn(C(C)C(=O)N(C)c4ccccc4)nn3)cc2)cc1 |
| InChI | InChI=1S/C28H25N5O2/c1-20(28(34)32(2)25-7-5-4-6-8-25)33-19-27(30-31-33)23-13-11-22(12-14-23)24(18-29)17-21-9-15-26(35-3)16-10-21/h4-17,19-20H,1-3H3/b24-17+ |
| InChIKey | CWKLRWIUDGUAPB-JJIBRWJFSA-N |
| XLogP | 5.24 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|