C26H20ClN5O — CID 142735799
3-[4-[4-[(Z)-2-(4-chlorophenyl)-1-cyanoethenyl]phenyl]triazol-1-yl]-N-phenylpropanamide (PubChem CID 142735799) has the molecular formula C26H20ClN5O and a molecular weight of 453.93 g/mol. Its IUPAC name is 3-[4-[4-[(Z)-2-(4-chlorophenyl)-1-cyanoethenyl]phenyl]triazol-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[4-[4-[(Z)-2-(4-chlorophenyl)-1-cyanoethenyl]phenyl]triazol-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 142735799 |
| Molecular Formula | C26H20ClN5O |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 3-[4-[4-[(Z)-2-(4-chlorophenyl)-1-cyanoethenyl]phenyl]triazol-1-yl]-N-phenylpropanamide |
| SMILES | N#C/C(=C\c1ccc(Cl)cc1)c1ccc(-c2cn(CCC(=O)Nc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C26H20ClN5O/c27-23-12-6-19(7-13-23)16-22(17-28)20-8-10-21(11-9-20)25-18-32(31-30-25)15-14-26(33)29-24-4-2-1-3-5-24/h1-13,16,18H,14-15H2,(H,29,33)/b22-16+ |
| InChIKey | DKRKZNJLODAKDN-CJLVFECKSA-N |
| XLogP | 5.69 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|