C19H14N4O3 — CID 76511800
N-[5-[1-cyano-2-(4-methoxyphenyl)ethenyl]-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 76511800) has the molecular formula C19H14N4O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is N-[5-[1-cyano-2-(4-methoxyphenyl)ethenyl]-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-[5-[1-cyano-2-(4-methoxyphenyl)ethenyl]-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 76511800 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[5-[1-cyano-2-(4-methoxyphenyl)ethenyl]-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | COc1ccc(C=C(C#N)c2nnc(NC(=O)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C19H14N4O3/c1-25-16-9-7-13(8-10-16)11-15(12-20)18-22-23-19(26-18)21-17(24)14-5-3-2-4-6-14/h2-11H,1H3,(H,21,23,24) |
| InChIKey | WMHJQVQCBDYHKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|