C37H40N2 — CID 143916414
(Z)-3-[4-(N-phenylanilino)phenyl]-2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]prop-2-enenitrile (PubChem CID 143916414) has the molecular formula C37H40N2 and a molecular weight of 512.74 g/mol. Its IUPAC name is (Z)-3-[4-(N-phenylanilino)phenyl]-2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(N-phenylanilino)phenyl]-2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 143916414 |
| Molecular Formula | C37H40N2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | (Z)-3-[4-(N-phenylanilino)phenyl]-2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]prop-2-enenitrile |
| SMILES | CC(C)(C)CC(c1ccc(/C(C#N)=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C37H40N2/c1-36(2,3)26-35(37(4,5)6)30-21-19-29(20-22-30)31(27-38)25-28-17-23-34(24-18-28)39(32-13-9-7-10-14-32)33-15-11-8-12-16-33/h7-25,35H,26H2,1-6H3/b31-25+ |
| InChIKey | YXGQRFVMCAGCGO-QCKNELIISA-N |
| XLogP | 10.79 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|