C24H29ClFNO — CID 164901752
2-[4-[(1Z,3E)-2-chloro-1-(4-fluorophenyl)-3-methylpenta-1,3-dienyl]phenoxy]-N,N-diethylethanamine (PubChem CID 164901752) has the molecular formula C24H29ClFNO and a molecular weight of 401.95 g/mol. Its IUPAC name is 2-[4-[(1Z,3E)-2-chloro-1-(4-fluorophenyl)-3-methylpenta-1,3-dienyl]phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-[(1Z,3E)-2-chloro-1-(4-fluorophenyl)-3-methylpenta-1,3-dienyl]phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 164901752 |
| Molecular Formula | C24H29ClFNO |
| Molecular Weight | 401.95 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-[4-[(1Z,3E)-2-chloro-1-(4-fluorophenyl)-3-methylpenta-1,3-dienyl]phenoxy]-N,N-diethylethanamine |
| SMILES | C/C=C(C)/C(Cl)=C(/c1ccc(F)cc1)c1ccc(OCCN(CC)CC)cc1 |
| InChI | InChI=1S/C24H29ClFNO/c1-5-18(4)24(25)23(19-8-12-21(26)13-9-19)20-10-14-22(15-11-20)28-17-16-27(6-2)7-3/h5,8-15H,6-7,16-17H2,1-4H3/b18-5+,24-23+ |
| InChIKey | UEJGBBBJXLYVDE-UBGMJZJCSA-N |
| XLogP | 6.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.95 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|