C25H25BrO5 — CID 18443705
3-[4-[3-[4-(4-bromophenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid (PubChem CID 18443705) has the molecular formula C25H25BrO5 and a molecular weight of 485.37 g/mol. Its IUPAC name is 3-[4-[3-[4-(4-bromophenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid.
| Compound Name | 3-[4-[3-[4-(4-bromophenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 18443705 |
| Molecular Formula | C25H25BrO5 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 3-[4-[3-[4-(4-bromophenyl)phenoxy]propoxy]phenyl]-2-methoxypropanoic acid |
| SMILES | COC(Cc1ccc(OCCCOc2ccc(-c3ccc(Br)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H25BrO5/c1-29-24(25(27)28)17-18-3-11-22(12-4-18)30-15-2-16-31-23-13-7-20(8-14-23)19-5-9-21(26)10-6-19/h3-14,24H,2,15-17H2,1H3,(H,27,28) |
| InChIKey | OIQBPCPWEFWAJG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|